About 2-formamido-2-methyl-N,N-dipropylpropanamide
2-formamido-2-methyl-N,N-dipropylpropanamide (PubChem CID 88885839) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-formamido-2-methyl-N,N-dipropylpropanamide.
Molecular Properties
| Compound Name | 2-formamido-2-methyl-N,N-dipropylpropanamide |
| PubChem CID | 88885839 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-formamido-2-methyl-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C(C)(C)NC=O |
| InChI | InChI=1S/C11H22N2O2/c1-5-7-13(8-6-2)10(15)11(3,4)12-9-14/h9H,5-8H2,1-4H3,(H,12,14) |
| InChIKey | UPGFYWKRCCXWGK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formamido-2-methyl-N,N-dipropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formamido-2-methyl-N,N-dipropylpropanamide?
The IUPAC name of 2-formamido-2-methyl-N,N-dipropylpropanamide (CID 88885839) is 2-formamido-2-methyl-N,N-dipropylpropanamide.
What is the SMILES notation for 2-formamido-2-methyl-N,N-dipropylpropanamide?
The canonical SMILES for 2-formamido-2-methyl-N,N-dipropylpropanamide is CCCN(CCC)C(=O)C(C)(C)NC=O.
What is the InChIKey of 2-formamido-2-methyl-N,N-dipropylpropanamide?
The InChIKey is UPGFYWKRCCXWGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-5-7-13(8-6-2)10(15)11(3,4)12-9-14/h9H,5-8H2,1-4H3,(H,12,14).
What are the key properties of 2-formamido-2-methyl-N,N-dipropylpropanamide?
2-formamido-2-methyl-N,N-dipropylpropanamide has a molecular weight of 214.31 g/mol, XLogP of 1.16, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formamido-2-methyl-N,N-dipropylpropanamide is sourced from PubChem (CID 88885839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).