C10H19F3N2O — CID 79791210
2-amino-3,3,3-trifluoro-2-methyl-N,N-dipropylpropanamide (PubChem CID 79791210) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-2-methyl-N,N-dipropylpropanamide.
| Compound Name | 2-amino-3,3,3-trifluoro-2-methyl-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 79791210 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-2-methyl-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-4-6-15(7-5-2)8(16)9(3,14)10(11,12)13/h4-7,14H2,1-3H3 |
| InChIKey | BOBAUGFFVRUODP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |