C12H23F3N2O — CID 79796610
2-amino-N,N-dibutyl-3,3,3-trifluoro-2-methylpropanamide (PubChem CID 79796610) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-amino-N,N-dibutyl-3,3,3-trifluoro-2-methylpropanamide.
| Compound Name | 2-amino-N,N-dibutyl-3,3,3-trifluoro-2-methylpropanamide |
|---|---|
| PubChem CID | 79796610 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-amino-N,N-dibutyl-3,3,3-trifluoro-2-methylpropanamide |
| SMILES | CCCCN(CCCC)C(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C12H23F3N2O/c1-4-6-8-17(9-7-5-2)10(18)11(3,16)12(13,14)15/h4-9,16H2,1-3H3 |
| InChIKey | GGVYEEDDTKAETL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |