C16H29N3O3 — CID 108961072
3-(4-formylpiperazin-1-yl)-2,2-dimethyl-3-oxo-N,N-dipropylpropanamide (PubChem CID 108961072) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-(4-formylpiperazin-1-yl)-2,2-dimethyl-3-oxo-N,N-dipropylpropanamide.
| Compound Name | 3-(4-formylpiperazin-1-yl)-2,2-dimethyl-3-oxo-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 108961072 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 3-(4-formylpiperazin-1-yl)-2,2-dimethyl-3-oxo-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)C(C)(C)C(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C16H29N3O3/c1-5-7-18(8-6-2)14(21)16(3,4)15(22)19-11-9-17(13-20)10-12-19/h13H,5-12H2,1-4H3 |
| InChIKey | PXBAMPISQWSHQX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|