C22H25N7O7 — CID 15234496
(3S)-4-[[(S)-carboxy(phenyl)methyl]amino]-3-[[2-[[4-(diaminomethylideneamino)phenyl]carbamoylamino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 15234496) has the molecular formula C22H25N7O7 and a molecular weight of 499.48 g/mol. Its IUPAC name is (3S)-4-[[(S)-carboxy(phenyl)methyl]amino]-3-[[2-[[4-(diaminomethylideneamino)phenyl]carbamoylamino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(S)-carboxy(phenyl)methyl]amino]-3-[[2-[[4-(diaminomethylideneamino)phenyl]carbamoylamino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 15234496 |
| Molecular Formula | C22H25N7O7 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (3S)-4-[[(S)-carboxy(phenyl)methyl]amino]-3-[[2-[[4-(diaminomethylideneamino)phenyl]carbamoylamino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=Nc1ccc(NC(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N7O7/c23-21(24)26-13-6-8-14(9-7-13)27-22(36)25-11-16(30)28-15(10-17(31)32)19(33)29-18(20(34)35)12-4-2-1-3-5-12/h1-9,15,18H,10-11H2,(H,28,30)(H,29,33)(H,31,32)(H,34,35)(H4,23,24,26)(H2,25,27,36)/t15-,18-/m0/s1 |
| InChIKey | UZOUSQJBJOQVDE-YJBOKZPZSA-N |
| XLogP | -0.39 |
| TPSA | 238.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|