C26H27N7O6 — CID 69462645
4-(diaminomethylideneamino)-N-[2-[[(2S)-3-hydroxy-2-[(4-phenoxyphenyl)carbamoylamino]propanoyl]amino]acetyl]benzamide (PubChem CID 69462645) has the molecular formula C26H27N7O6 and a molecular weight of 533.55 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-N-[2-[[(2S)-3-hydroxy-2-[(4-phenoxyphenyl)carbamoylamino]propanoyl]amino]acetyl]benzamide.
| Compound Name | 4-(diaminomethylideneamino)-N-[2-[[(2S)-3-hydroxy-2-[(4-phenoxyphenyl)carbamoylamino]propanoyl]amino]acetyl]benzamide |
|---|---|
| PubChem CID | 69462645 |
| Molecular Formula | C26H27N7O6 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 4-(diaminomethylideneamino)-N-[2-[[(2S)-3-hydroxy-2-[(4-phenoxyphenyl)carbamoylamino]propanoyl]amino]acetyl]benzamide |
| SMILES | NC(N)=Nc1ccc(C(=O)NC(=O)CNC(=O)[C@H](CO)NC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H27N7O6/c27-25(28)30-17-8-6-16(7-9-17)23(36)33-22(35)14-29-24(37)21(15-34)32-26(38)31-18-10-12-20(13-11-18)39-19-4-2-1-3-5-19/h1-13,21,34H,14-15H2,(H,29,37)(H4,27,28,30)(H2,31,32,38)(H,33,35,36)/t21-/m0/s1 |
| InChIKey | JMCHLHBTQJXPLW-NRFANRHFSA-N |
| XLogP | 0.94 |
| TPSA | 210.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|