C23H26N6O7 — CID 142666742
(3S)-3-[[2-[(4-methanehydrazonoylphenyl)carbamoylamino]acetyl]amino]-4-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-4-oxobutanoic acid (PubChem CID 142666742) has the molecular formula C23H26N6O7 and a molecular weight of 498.50 g/mol. Its IUPAC name is (3S)-3-[[2-[(4-methanehydrazonoylphenyl)carbamoylamino]acetyl]amino]-4-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[2-[(4-methanehydrazonoylphenyl)carbamoylamino]acetyl]amino]-4-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 142666742 |
| Molecular Formula | C23H26N6O7 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (3S)-3-[[2-[(4-methanehydrazonoylphenyl)carbamoylamino]acetyl]amino]-4-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)Nc1ccc(C=NN)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N6O7/c1-36-22(34)20(15-5-3-2-4-6-15)29-21(33)17(11-19(31)32)28-18(30)13-25-23(35)27-16-9-7-14(8-10-16)12-26-24/h2-10,12,17,20H,11,13,24H2,1H3,(H,28,30)(H,29,33)(H,31,32)(H2,25,27,35)/t17-,20-/m0/s1 |
| InChIKey | XHPCAIZVDHFIFO-PXNSSMCTSA-N |
| XLogP | 0.09 |
| TPSA | 201.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|