C26H29F3N6O9 — CID 67644480
methyl (3S)-3-acetamido-4-(N-[(1R)-1-[(4-methanehydrazonoylphenyl)carbamoylamino]-2-methoxy-2-oxoethyl]anilino)-4-oxobutanoate;2,2,2-trifluoroacetic acid (PubChem CID 67644480) has the molecular formula C26H29F3N6O9 and a molecular weight of 626.55 g/mol. Its IUPAC name is methyl (3S)-3-acetamido-4-(N-[(1R)-1-[(4-methanehydrazonoylphenyl)carbamoylamino]-2-methoxy-2-oxoethyl]anilino)-4-oxobutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (3S)-3-acetamido-4-(N-[(1R)-1-[(4-methanehydrazonoylphenyl)carbamoylamino]-2-methoxy-2-oxoethyl]anilino)-4-oxobutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67644480 |
| Molecular Formula | C26H29F3N6O9 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | methyl (3S)-3-acetamido-4-(N-[(1R)-1-[(4-methanehydrazonoylphenyl)carbamoylamino]-2-methoxy-2-oxoethyl]anilino)-4-oxobutanoate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)C[C@H](NC(C)=O)C(=O)N(c1ccccc1)[C@@H](NC(=O)Nc1ccc(C=NN)cc1)C(=O)OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H28N6O7.C2HF3O2/c1-15(31)27-19(13-20(32)36-2)22(33)30(18-7-5-4-6-8-18)21(23(34)37-3)29-24(35)28-17-11-9-16(10-12-17)14-26-25;3-2(4,5)1(6)7/h4-12,14,19,21H,13,25H2,1-3H3,(H,27,31)(H2,28,29,35);(H,6,7)/t19-,21+;/m0./s1 |
| InChIKey | NBGDZVXLZURVMV-LZAGWAHOSA-N |
| XLogP | 1.33 |
| TPSA | 218.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|