C13H16N2O5S — CID 63307009
(2S)-4-methoxy-2-[(4-methylsulfanylphenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 63307009) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is (2S)-4-methoxy-2-[(4-methylsulfanylphenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-methoxy-2-[(4-methylsulfanylphenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307009 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (2S)-4-methoxy-2-[(4-methylsulfanylphenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)Nc1ccc(SC)cc1)C(=O)O |
| InChI | InChI=1S/C13H16N2O5S/c1-20-11(16)7-10(12(17)18)15-13(19)14-8-3-5-9(21-2)6-4-8/h3-6,10H,7H2,1-2H3,(H,17,18)(H2,14,15,19)/t10-/m0/s1 |
| InChIKey | BILVYVFMJWFVRM-JTQLQIEISA-N |
| XLogP | 1.55 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |