C13H18N2O3S — CID 61183128
(2S)-3-methyl-2-[(4-methylsulfanylphenyl)carbamoylamino]butanoic acid (PubChem CID 61183128) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(4-methylsulfanylphenyl)carbamoylamino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[(4-methylsulfanylphenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 61183128 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2S)-3-methyl-2-[(4-methylsulfanylphenyl)carbamoylamino]butanoic acid |
| SMILES | CSc1ccc(NC(=O)N[C@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-8(2)11(12(16)17)15-13(18)14-9-4-6-10(19-3)7-5-9/h4-8,11H,1-3H3,(H,16,17)(H2,14,15,18)/t11-/m0/s1 |
| InChIKey | RBWDXVJGGKBVKW-NSHDSACASA-N |
| XLogP | 2.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |