C21H19F3N4O3 — CID 70058150
1-benzyl-3-(6-methanehydrazonoylnaphthalen-2-yl)urea;2,2,2-trifluoroacetic acid (PubChem CID 70058150) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is 1-benzyl-3-(6-methanehydrazonoylnaphthalen-2-yl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-benzyl-3-(6-methanehydrazonoylnaphthalen-2-yl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70058150 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-benzyl-3-(6-methanehydrazonoylnaphthalen-2-yl)urea;2,2,2-trifluoroacetic acid |
| SMILES | NN=Cc1ccc2cc(NC(=O)NCc3ccccc3)ccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H18N4O.C2HF3O2/c20-22-13-15-6-7-17-11-18(9-8-16(17)10-15)23-19(24)21-12-14-4-2-1-3-5-14;3-2(4,5)1(6)7/h1-11,13H,12,20H2,(H2,21,23,24);(H,6,7) |
| InChIKey | HNAWACFBQYQKEC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|