C24H25N5O7 — CID 70055914
(3S)-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-3-[[4-(4-methanehydrazonoylanilino)-4-oxobut-2-enoyl]amino]-4-oxobutanoic acid (PubChem CID 70055914) has the molecular formula C24H25N5O7 and a molecular weight of 495.49 g/mol. Its IUPAC name is (3S)-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-3-[[4-(4-methanehydrazonoylanilino)-4-oxobut-2-enoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-3-[[4-(4-methanehydrazonoylanilino)-4-oxobut-2-enoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70055914 |
| Molecular Formula | C24H25N5O7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (3S)-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-3-[[4-(4-methanehydrazonoylanilino)-4-oxobut-2-enoyl]amino]-4-oxobutanoic acid |
| SMILES | NN=Cc1ccc(NC(=O)C=CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H25N5O7/c25-26-14-16-6-8-17(9-7-16)27-20(30)10-11-21(31)28-18(13-22(32)33)23(34)29-19(24(35)36)12-15-4-2-1-3-5-15/h1-11,14,18-19H,12-13,25H2,(H,27,30)(H,28,31)(H,29,34)(H,32,33)(H,35,36)/t18-,19-/m0/s1 |
| InChIKey | MKMCIJHOPMFWRR-OALUTQOASA-N |
| XLogP | 0.25 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|