C20H21N5O4 — CID 67807699
2-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclopropanecarbonyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 67807699) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclopropanecarbonyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 2-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclopropanecarbonyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 67807699 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclopropanecarbonyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | NN=Cc1ccc(NC(=O)C2CC2C(=O)NC(Cc2cccnc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H21N5O4/c21-23-11-12-3-5-14(6-4-12)24-18(26)15-9-16(15)19(27)25-17(20(28)29)8-13-2-1-7-22-10-13/h1-7,10-11,15-17H,8-9,21H2,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | ZJGGZQXCIXSNMK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|