C16H17N3O4 — CID 146337673
(2S)-2-[(4-aminophenyl)methoxycarbonylamino]-3-pyridin-3-ylpropanoic acid (PubChem CID 146337673) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is (2S)-2-[(4-aminophenyl)methoxycarbonylamino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | (2S)-2-[(4-aminophenyl)methoxycarbonylamino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 146337673 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2S)-2-[(4-aminophenyl)methoxycarbonylamino]-3-pyridin-3-ylpropanoic acid |
| SMILES | Nc1ccc(COC(=O)N[C@@H](Cc2cccnc2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H17N3O4/c17-13-5-3-11(4-6-13)10-23-16(22)19-14(15(20)21)8-12-2-1-7-18-9-12/h1-7,9,14H,8,10,17H2,(H,19,22)(H,20,21)/t14-/m0/s1 |
| InChIKey | BOCHZWZAQZYEOR-AWEZNQCLSA-N |
| XLogP | 1.59 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|