C22H24N4O4 — CID 67877386
3-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclobutanecarbonyl]amino]-3-phenylpropanoic acid (PubChem CID 67877386) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclobutanecarbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 3-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclobutanecarbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67877386 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[[2-[(4-methanehydrazonoylphenyl)carbamoyl]cyclobutanecarbonyl]amino]-3-phenylpropanoic acid |
| SMILES | NN=Cc1ccc(NC(=O)C2CCC2C(=O)NC(CC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N4O4/c23-24-13-14-6-8-16(9-7-14)25-21(29)17-10-11-18(17)22(30)26-19(12-20(27)28)15-4-2-1-3-5-15/h1-9,13,17-19H,10-12,23H2,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | WGVLXHSVDRMXKN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|