C24H27N5O5 — CID 70246788
3-[[2-[3-ethyl-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 70246788) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is 3-[[2-[3-ethyl-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 3-[[2-[3-ethyl-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70246788 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 3-[[2-[3-ethyl-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | CCN1C(=O)N(CC(=O)NC(CC(=O)O)c2ccccc2)C(=O)C1(C)c1ccc(C=NN)cc1 |
| InChI | InChI=1S/C24H27N5O5/c1-3-29-23(34)28(22(33)24(29,2)18-11-9-16(10-12-18)14-26-25)15-20(30)27-19(13-21(31)32)17-7-5-4-6-8-17/h4-12,14,19H,3,13,15,25H2,1-2H3,(H,27,30)(H,31,32) |
| InChIKey | ABIXXWHLBYTDRJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 145.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|