C24H26FN3O5 — CID 46516380
propan-2-yl 3-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoate (PubChem CID 46516380) has the molecular formula C24H26FN3O5 and a molecular weight of 455.49 g/mol. Its IUPAC name is propan-2-yl 3-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 46516380 |
| Molecular Formula | C24H26FN3O5 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | propan-2-yl 3-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CN1C(=O)NC(C)(c2ccc(F)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C24H26FN3O5/c1-15(2)33-21(30)13-19(16-7-5-4-6-8-16)26-20(29)14-28-22(31)24(3,27-23(28)32)17-9-11-18(25)12-10-17/h4-12,15,19H,13-14H2,1-3H3,(H,26,29)(H,27,32) |
| InChIKey | CSXHUWGBLZINMO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|