C24H26N6O7 — CID 67601161
3-[[2-[4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 67601161) has the molecular formula C24H26N6O7 and a molecular weight of 510.51 g/mol. Its IUPAC name is 3-[[2-[4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[[2-[4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 67601161 |
| Molecular Formula | C24H26N6O7 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 3-[[2-[4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CC1(c2ccc(C=NN)cc2)NC(=O)N(CC(=O)NCC(NC(=O)OCc2ccccc2)C(=O)O)C1=O |
| InChI | InChI=1S/C24H26N6O7/c1-24(17-9-7-15(8-10-17)11-27-25)21(34)30(22(35)29-24)13-19(31)26-12-18(20(32)33)28-23(36)37-14-16-5-3-2-4-6-16/h2-11,18H,12-14,25H2,1H3,(H,26,31)(H,28,36)(H,29,35)(H,32,33) |
| InChIKey | HVPSFTCSEQOGSG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 192.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|