C24H26N6O7 — CID 70246084
3-[[2-[(4S)-4-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 70246084) has the molecular formula C24H26N6O7 and a molecular weight of 510.51 g/mol. Its IUPAC name is 3-[[2-[(4S)-4-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[[2-[(4S)-4-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70246084 |
| Molecular Formula | C24H26N6O7 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 3-[[2-[(4S)-4-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C[C@@H]2NC(=O)N(CC(=O)NCC(NC(=O)OCc3ccccc3)C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C24H26N6O7/c25-20(26)16-8-6-14(7-9-16)10-17-21(32)30(23(35)28-17)12-19(31)27-11-18(22(33)34)29-24(36)37-13-15-4-2-1-3-5-15/h1-9,17-18H,10-13H2,(H3,25,26)(H,27,31)(H,28,35)(H,29,36)(H,33,34)/t17-,18?/m0/s1 |
| InChIKey | IFCXBYVHENTBMW-ZENAZSQFSA-N |
| XLogP | -0.07 |
| TPSA | 204.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|