C28H34N6O7 — CID 70246693
tert-butyl (2S)-3-[acetyl-[(4R)-4-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]amino]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 70246693) has the molecular formula C28H34N6O7 and a molecular weight of 566.62 g/mol. Its IUPAC name is tert-butyl (2S)-3-[acetyl-[(4R)-4-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]amino]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-[acetyl-[(4R)-4-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]amino]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 70246693 |
| Molecular Formula | C28H34N6O7 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | tert-butyl (2S)-3-[acetyl-[(4R)-4-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]amino]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H]2NC(=O)N(N(C[C@H](NC(=O)OCc3ccccc3)C(=O)OC(C)(C)C)C(C)=O)C2=O)cc1 |
| InChI | InChI=1S/C28H34N6O7/c1-17(35)33(34-24(36)21(31-26(34)38)14-18-10-12-20(13-11-18)23(29)30)15-22(25(37)41-28(2,3)4)32-27(39)40-16-19-8-6-5-7-9-19/h5-13,21-22H,14-16H2,1-4H3,(H3,29,30)(H,31,38)(H,32,39)/t21-,22+/m1/s1 |
| InChIKey | PLUSWBIBMRIELG-YADHBBJMSA-N |
| XLogP | 1.83 |
| TPSA | 184.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|