C22H25N7O6 — CID 59873390
3-[[2-[(4R)-4-[2-(diaminomethylideneamino)ethyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(naphthalene-2-carbonylamino)propanoic acid (PubChem CID 59873390) has the molecular formula C22H25N7O6 and a molecular weight of 483.49 g/mol. Its IUPAC name is 3-[[2-[(4R)-4-[2-(diaminomethylideneamino)ethyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(naphthalene-2-carbonylamino)propanoic acid.
| Compound Name | 3-[[2-[(4R)-4-[2-(diaminomethylideneamino)ethyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(naphthalene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 59873390 |
| Molecular Formula | C22H25N7O6 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-[[2-[(4R)-4-[2-(diaminomethylideneamino)ethyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(naphthalene-2-carbonylamino)propanoic acid |
| SMILES | NC(N)=NCC[C@H]1NC(=O)N(CC(=O)NCC(NC(=O)c2ccc3ccccc3c2)C(=O)O)C1=O |
| InChI | InChI=1S/C22H25N7O6/c23-21(24)25-8-7-15-19(32)29(22(35)28-15)11-17(30)26-10-16(20(33)34)27-18(31)14-6-5-12-3-1-2-4-13(12)9-14/h1-6,9,15-16H,7-8,10-11H2,(H,26,30)(H,27,31)(H,28,35)(H,33,34)(H4,23,24,25)/t15-,16?/m1/s1 |
| InChIKey | KODAWWRWZOHLOB-AAFJCEBUSA-N |
| XLogP | -1.28 |
| TPSA | 209.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|