C31H39N7O3 — CID 127054127
N-[[(3R,5R)-1-(2-acetamido-2-phenylethyl)-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide (PubChem CID 127054127) has the molecular formula C31H39N7O3 and a molecular weight of 557.70 g/mol. Its IUPAC name is N-[[(3R,5R)-1-(2-acetamido-2-phenylethyl)-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide.
| Compound Name | N-[[(3R,5R)-1-(2-acetamido-2-phenylethyl)-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 127054127 |
| Molecular Formula | C31H39N7O3 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | N-[[(3R,5R)-1-(2-acetamido-2-phenylethyl)-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
| SMILES | CC(=O)NC(CN1CC[C@H](CNC(=O)c2ccc3ccccc3c2)N[C@H](CCCN=C(N)N)C1=O)c1ccccc1 |
| InChI | InChI=1S/C31H39N7O3/c1-21(39)36-28(23-9-3-2-4-10-23)20-38-17-15-26(37-27(30(38)41)12-7-16-34-31(32)33)19-35-29(40)25-14-13-22-8-5-6-11-24(22)18-25/h2-6,8-11,13-14,18,26-28,37H,7,12,15-17,19-20H2,1H3,(H,35,40)(H,36,39)(H4,32,33,34)/t26-,27-,28?/m1/s1 |
| InChIKey | ITFIOTBKZZKPDD-GORYFVAVSA-N |
| XLogP | 2.06 |
| TPSA | 154.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|