C32H38ClIN6O2 — CID 89410718
3-chloro-N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-5-(iodomethyl)benzamide (PubChem CID 89410718) has the molecular formula C32H38ClIN6O2 and a molecular weight of 701.05 g/mol. Its IUPAC name is 3-chloro-N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-5-(iodomethyl)benzamide.
| Compound Name | 3-chloro-N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-5-(iodomethyl)benzamide |
|---|---|
| PubChem CID | 89410718 |
| Molecular Formula | C32H38ClIN6O2 |
| Molecular Weight | 701.05 g/mol |
| Exact Mass | 700.18 |
| IUPAC Name | 3-chloro-N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-5-(iodomethyl)benzamide |
| SMILES | NC(N)=NCCC[C@@H]1N[C@H](CNC(=O)c2cc(Cl)cc(CI)c2)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C32H38ClIN6O2/c33-26-17-22(19-34)16-25(18-26)30(41)38-20-27-13-15-40(31(42)29(39-27)12-7-14-37-32(35)36)21-28(23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-11,16-18,27-29,39H,7,12-15,19-21H2,(H,38,41)(H4,35,36,37)/t27-,29-/m0/s1 |
| InChIKey | JVRGBEWNJNCZTH-YTMVLYRLSA-N |
| XLogP | 4.45 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.05 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|