C33H39ClN6O2 — CID 91032967
3-(2-chlorophenyl)-N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]prop-2-enamide (PubChem CID 91032967) has the molecular formula C33H39ClN6O2 and a molecular weight of 587.17 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 91032967 |
| Molecular Formula | C33H39ClN6O2 |
| Molecular Weight | 587.17 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]prop-2-enamide |
| SMILES | NC(N)=NCCC[C@@H]1N[C@H](CNC(=O)C=Cc2ccccc2Cl)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C33H39ClN6O2/c34-29-15-8-7-14-26(29)17-18-31(41)38-22-27-19-21-40(32(42)30(39-27)16-9-20-37-33(35)36)23-28(24-10-3-1-4-11-24)25-12-5-2-6-13-25/h1-8,10-15,17-18,27-28,30,39H,9,16,19-23H2,(H,38,41)(H4,35,36,37)/t27-,30-/m0/s1 |
| InChIKey | ZENRZOUEURYXBY-FIBWVYCGSA-N |
| XLogP | 3.91 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|