C35H41ClN4O2 — CID 143853105
(E)-3-(4-chlorophenyl)-N-[[1-(2,2-diphenylethyl)-2-oxo-3-(2-pyrrolidin-1-ylethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide (PubChem CID 143853105) has the molecular formula C35H41ClN4O2 and a molecular weight of 585.19 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[1-(2,2-diphenylethyl)-2-oxo-3-(2-pyrrolidin-1-ylethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[1-(2,2-diphenylethyl)-2-oxo-3-(2-pyrrolidin-1-ylethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 143853105 |
| Molecular Formula | C35H41ClN4O2 |
| Molecular Weight | 585.19 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[1-(2,2-diphenylethyl)-2-oxo-3-(2-pyrrolidin-1-ylethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NCC1CCN(CC(c2ccccc2)c2ccccc2)C(=O)C(CCN2CCCC2)N1 |
| InChI | InChI=1S/C35H41ClN4O2/c36-30-16-13-27(14-17-30)15-18-34(41)37-25-31-19-24-40(35(42)33(38-31)20-23-39-21-7-8-22-39)26-32(28-9-3-1-4-10-28)29-11-5-2-6-12-29/h1-6,9-18,31-33,38H,7-8,19-26H2,(H,37,41)/b18-15+ |
| InChIKey | KNHJCOXBCSOUDJ-OBGWFSINSA-N |
| XLogP | 5.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.19 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|