C32H43IN4O2 — CID 89148405
(E)-3-(4-iodophenyl)-N-[[(3S,5S)-2-oxo-1-[(2S)-2-phenylbutyl]-3-(2-piperidin-1-ylethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide (PubChem CID 89148405) has the molecular formula C32H43IN4O2 and a molecular weight of 642.63 g/mol. Its IUPAC name is (E)-3-(4-iodophenyl)-N-[[(3S,5S)-2-oxo-1-[(2S)-2-phenylbutyl]-3-(2-piperidin-1-ylethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-iodophenyl)-N-[[(3S,5S)-2-oxo-1-[(2S)-2-phenylbutyl]-3-(2-piperidin-1-ylethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 89148405 |
| Molecular Formula | C32H43IN4O2 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | (E)-3-(4-iodophenyl)-N-[[(3S,5S)-2-oxo-1-[(2S)-2-phenylbutyl]-3-(2-piperidin-1-ylethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide |
| SMILES | CC[C@H](CN1CC[C@@H](CNC(=O)/C=C/c2ccc(I)cc2)N[C@@H](CCN2CCCCC2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C32H43IN4O2/c1-2-26(27-9-5-3-6-10-27)24-37-22-17-29(23-34-31(38)16-13-25-11-14-28(33)15-12-25)35-30(32(37)39)18-21-36-19-7-4-8-20-36/h3,5-6,9-16,26,29-30,35H,2,4,7-8,17-24H2,1H3,(H,34,38)/b16-13+/t26-,29+,30+/m1/s1 |
| InChIKey | GHPUAZUMGPQNJW-MDJFSFQJSA-N |
| XLogP | 5.05 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|