C37H44ClN3O2 — CID 68634788
3-(4-chlorophenyl)-N-[[(3S,5S)-3-(2-cyclohexylethyl)-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]prop-2-enamide (PubChem CID 68634788) has the molecular formula C37H44ClN3O2 and a molecular weight of 598.23 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[[(3S,5S)-3-(2-cyclohexylethyl)-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-[[(3S,5S)-3-(2-cyclohexylethyl)-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 68634788 |
| Molecular Formula | C37H44ClN3O2 |
| Molecular Weight | 598.23 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[[(3S,5S)-3-(2-cyclohexylethyl)-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)NC[C@@H]1CCN(CC(c2ccccc2)c2ccccc2)C(=O)[C@H](CCC2CCCCC2)N1 |
| InChI | InChI=1S/C37H44ClN3O2/c38-32-20-16-29(17-21-32)19-23-36(42)39-26-33-24-25-41(37(43)35(40-33)22-18-28-10-4-1-5-11-28)27-34(30-12-6-2-7-13-30)31-14-8-3-9-15-31/h2-3,6-9,12-17,19-21,23,28,33-35,40H,1,4-5,10-11,18,22,24-27H2,(H,39,42)/t33-,35-/m0/s1 |
| InChIKey | QVMNGLCQSTYHBW-LRHLLKFHSA-N |
| XLogP | 7.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.23 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|