C40H50N4O3 — CID 67372065
N-[3-[(2S,7S)-4-(2,2-diphenylethyl)-7-[[3-(4-methylphenyl)prop-2-enoylamino]methyl]-3-oxo-1,4-diazepan-2-yl]propyl]cyclohexanecarboxamide (PubChem CID 67372065) has the molecular formula C40H50N4O3 and a molecular weight of 634.87 g/mol. Its IUPAC name is N-[3-[(2S,7S)-4-(2,2-diphenylethyl)-7-[[3-(4-methylphenyl)prop-2-enoylamino]methyl]-3-oxo-1,4-diazepan-2-yl]propyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[(2S,7S)-4-(2,2-diphenylethyl)-7-[[3-(4-methylphenyl)prop-2-enoylamino]methyl]-3-oxo-1,4-diazepan-2-yl]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 67372065 |
| Molecular Formula | C40H50N4O3 |
| Molecular Weight | 634.87 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | N-[3-[(2S,7S)-4-(2,2-diphenylethyl)-7-[[3-(4-methylphenyl)prop-2-enoylamino]methyl]-3-oxo-1,4-diazepan-2-yl]propyl]cyclohexanecarboxamide |
| SMILES | Cc1ccc(C=CC(=O)NC[C@@H]2CCN(CC(c3ccccc3)c3ccccc3)C(=O)[C@H](CCCNC(=O)C3CCCCC3)N2)cc1 |
| InChI | InChI=1S/C40H50N4O3/c1-30-19-21-31(22-20-30)23-24-38(45)42-28-35-25-27-44(29-36(32-12-5-2-6-13-32)33-14-7-3-8-15-33)40(47)37(43-35)18-11-26-41-39(46)34-16-9-4-10-17-34/h2-3,5-8,12-15,19-24,34-37,43H,4,9-11,16-18,25-29H2,1H3,(H,41,46)(H,42,45)/t35-,37-/m0/s1 |
| InChIKey | SJPFDTCYOWNRRA-JSXFGMRASA-N |
| XLogP | 5.99 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.87 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|