C32H35IN4O3 — CID 89148398
3-[(2S,7S)-4-(2,2-diphenylethyl)-7-[[[(E)-3-(4-iodophenyl)prop-2-enoyl]amino]methyl]-3-oxo-1,4-diazepan-2-yl]propanamide (PubChem CID 89148398) has the molecular formula C32H35IN4O3 and a molecular weight of 650.56 g/mol. Its IUPAC name is 3-[(2S,7S)-4-(2,2-diphenylethyl)-7-[[[(E)-3-(4-iodophenyl)prop-2-enoyl]amino]methyl]-3-oxo-1,4-diazepan-2-yl]propanamide.
| Compound Name | 3-[(2S,7S)-4-(2,2-diphenylethyl)-7-[[[(E)-3-(4-iodophenyl)prop-2-enoyl]amino]methyl]-3-oxo-1,4-diazepan-2-yl]propanamide |
|---|---|
| PubChem CID | 89148398 |
| Molecular Formula | C32H35IN4O3 |
| Molecular Weight | 650.56 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | 3-[(2S,7S)-4-(2,2-diphenylethyl)-7-[[[(E)-3-(4-iodophenyl)prop-2-enoyl]amino]methyl]-3-oxo-1,4-diazepan-2-yl]propanamide |
| SMILES | NC(=O)CC[C@@H]1N[C@H](CNC(=O)/C=C/c2ccc(I)cc2)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C32H35IN4O3/c33-26-14-11-23(12-15-26)13-18-31(39)35-21-27-19-20-37(32(40)29(36-27)16-17-30(34)38)22-28(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-15,18,27-29,36H,16-17,19-22H2,(H2,34,38)(H,35,39)/b18-13+/t27-,29-/m0/s1 |
| InChIKey | WMVXXONGJOFLMT-PXPNINDPSA-N |
| XLogP | 4.08 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|