C33H40N6O3 — CID 91497828
N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2-hydroxyphenyl)prop-2-enamide (PubChem CID 91497828) has the molecular formula C33H40N6O3 and a molecular weight of 568.72 g/mol. Its IUPAC name is N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2-hydroxyphenyl)prop-2-enamide.
| Compound Name | N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91497828 |
| Molecular Formula | C33H40N6O3 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2-hydroxyphenyl)prop-2-enamide |
| SMILES | NC(N)=NCCC[C@@H]1N[C@H](CNC(=O)C=Cc2ccccc2O)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C33H40N6O3/c34-33(35)36-20-9-15-29-32(42)39(23-28(24-10-3-1-4-11-24)25-12-5-2-6-13-25)21-19-27(38-29)22-37-31(41)18-17-26-14-7-8-16-30(26)40/h1-8,10-14,16-18,27-29,38,40H,9,15,19-23H2,(H,37,41)(H4,34,35,36)/t27-,29-/m0/s1 |
| InChIKey | ZUWYFRUXGNJKKL-YTMVLYRLSA-N |
| XLogP | 2.97 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|