C36H42N6O3 — CID 74952047
N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-1-methoxynaphthalene-2-carboxamide (PubChem CID 74952047) has the molecular formula C36H42N6O3 and a molecular weight of 606.77 g/mol. Its IUPAC name is N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-1-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-1-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 74952047 |
| Molecular Formula | C36H42N6O3 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-1-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NCC2CCN(CC(c3ccccc3)c3ccccc3)C(=O)C(CCCN=C(N)N)N2)ccc2ccccc12 |
| InChI | InChI=1S/C36H42N6O3/c1-45-33-29-16-9-8-15-27(29)18-19-30(33)34(43)40-23-28-20-22-42(35(44)32(41-28)17-10-21-39-36(37)38)24-31(25-11-4-2-5-12-25)26-13-6-3-7-14-26/h2-9,11-16,18-19,28,31-32,41H,10,17,20-24H2,1H3,(H,40,43)(H4,37,38,39) |
| InChIKey | HDAGSQJWWKSPBM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|