C33H38F2N6O2 — CID 90815320
N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2,6-difluorophenyl)prop-2-enamide (PubChem CID 90815320) has the molecular formula C33H38F2N6O2 and a molecular weight of 588.70 g/mol. Its IUPAC name is N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2,6-difluorophenyl)prop-2-enamide.
| Compound Name | N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2,6-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90815320 |
| Molecular Formula | C33H38F2N6O2 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-3-(2,6-difluorophenyl)prop-2-enamide |
| SMILES | NC(N)=NCCC[C@@H]1N[C@H](CNC(=O)C=Cc2c(F)cccc2F)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C33H38F2N6O2/c34-28-13-7-14-29(35)26(28)16-17-31(42)39-21-25-18-20-41(32(43)30(40-25)15-8-19-38-33(36)37)22-27(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-7,9-14,16-17,25,27,30,40H,8,15,18-22H2,(H,39,42)(H4,36,37,38)/t25-,30-/m0/s1 |
| InChIKey | ZZPYJOPHCYOACQ-QCDSWUKFSA-N |
| XLogP | 3.54 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|