C37H42N6O2 — CID 74951525
N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-4-phenylbenzamide (PubChem CID 74951525) has the molecular formula C37H42N6O2 and a molecular weight of 602.78 g/mol. Its IUPAC name is N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-4-phenylbenzamide.
| Compound Name | N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 74951525 |
| Molecular Formula | C37H42N6O2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-4-phenylbenzamide |
| SMILES | NC(N)=NCCCC1NC(CNC(=O)c2ccc(-c3ccccc3)cc2)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C37H42N6O2/c38-37(39)40-23-10-17-34-36(45)43(26-33(29-13-6-2-7-14-29)30-15-8-3-9-16-30)24-22-32(42-34)25-41-35(44)31-20-18-28(19-21-31)27-11-4-1-5-12-27/h1-9,11-16,18-21,32-34,42H,10,17,22-26H2,(H,41,44)(H4,38,39,40) |
| InChIKey | SEHSYULGJIALHX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|