C34H38N6O3 — CID 74952310
N-[[3-[2-(diaminomethylideneamino)oxyethyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide (PubChem CID 74952310) has the molecular formula C34H38N6O3 and a molecular weight of 578.72 g/mol. Its IUPAC name is N-[[3-[2-(diaminomethylideneamino)oxyethyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide.
| Compound Name | N-[[3-[2-(diaminomethylideneamino)oxyethyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 74952310 |
| Molecular Formula | C34H38N6O3 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | N-[[3-[2-(diaminomethylideneamino)oxyethyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
| SMILES | NC(N)=NOCCC1NC(CNC(=O)c2ccc3ccccc3c2)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C34H38N6O3/c35-34(36)39-43-20-18-31-33(42)40(23-30(25-10-3-1-4-11-25)26-12-5-2-6-13-26)19-17-29(38-31)22-37-32(41)28-16-15-24-9-7-8-14-27(24)21-28/h1-16,21,29-31,38H,17-20,22-23H2,(H,37,41)(H4,35,36,39) |
| InChIKey | FUKQUWBYBLOIRV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|