C36H42N6O3 — CID 67370014
N-[[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-6-methoxynaphthalene-2-carboxamide (PubChem CID 67370014) has the molecular formula C36H42N6O3 and a molecular weight of 606.77 g/mol. Its IUPAC name is N-[[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-6-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-6-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 67370014 |
| Molecular Formula | C36H42N6O3 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | N-[[(3S,5S)-3-[1-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-6-methoxynaphthalene-2-carboxamide |
| SMILES | CCC(N=C(N)N)[C@@H]1N[C@H](CNC(=O)c2ccc3cc(OC)ccc3c2)CCN(CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C36H42N6O3/c1-3-32(41-36(37)38)33-35(44)42(23-31(24-10-6-4-7-11-24)25-12-8-5-9-13-25)19-18-29(40-33)22-39-34(43)28-15-14-27-21-30(45-2)17-16-26(27)20-28/h4-17,20-21,29,31-33,40H,3,18-19,22-23H2,1-2H3,(H,39,43)(H4,37,38,41)/t29-,32?,33-/m0/s1 |
| InChIKey | XNIRKEXRSASJTO-LNEYNTRISA-N |
| XLogP | 4.02 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|