C35H38Cl2N6O2 — CID 127054119
N-[[(3R,5R)-1-[2,2-bis(4-chlorophenyl)ethyl]-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide (PubChem CID 127054119) has the molecular formula C35H38Cl2N6O2 and a molecular weight of 645.64 g/mol. Its IUPAC name is N-[[(3R,5R)-1-[2,2-bis(4-chlorophenyl)ethyl]-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide.
| Compound Name | N-[[(3R,5R)-1-[2,2-bis(4-chlorophenyl)ethyl]-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 127054119 |
| Molecular Formula | C35H38Cl2N6O2 |
| Molecular Weight | 645.64 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | N-[[(3R,5R)-1-[2,2-bis(4-chlorophenyl)ethyl]-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
| SMILES | NC(N)=NCCC[C@H]1N[C@@H](CNC(=O)c2ccc3ccccc3c2)CCN(CC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C35H38Cl2N6O2/c36-28-13-9-24(10-14-28)31(25-11-15-29(37)16-12-25)22-43-19-17-30(42-32(34(43)45)6-3-18-40-35(38)39)21-41-33(44)27-8-7-23-4-1-2-5-26(23)20-27/h1-2,4-5,7-16,20,30-32,42H,3,6,17-19,21-22H2,(H,41,44)(H4,38,39,40)/t30-,32-/m1/s1 |
| InChIKey | VJYVPFLTKPIWGV-XLJNKUFUSA-N |
| XLogP | 5.32 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|