C30H42N6O2 — CID 75230872
N-[[1-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide (PubChem CID 75230872) has the molecular formula C30H42N6O2 and a molecular weight of 518.71 g/mol. Its IUPAC name is N-[[1-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide.
| Compound Name | N-[[1-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 75230872 |
| Molecular Formula | C30H42N6O2 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | N-[[1-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
| SMILES | NC(N)=NCCCC1NC(CNC(=O)c2ccc3ccccc3c2)CCN(CCC2CC3CCC2C3)C1=O |
| InChI | InChI=1S/C30H42N6O2/c31-30(32)33-13-3-6-27-29(38)36(14-11-24-17-20-7-8-23(24)16-20)15-12-26(35-27)19-34-28(37)25-10-9-21-4-1-2-5-22(21)18-25/h1-2,4-5,9-10,18,20,23-24,26-27,35H,3,6-8,11-17,19H2,(H,34,37)(H4,31,32,33) |
| InChIKey | LLSPVLURZFRKQC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|