C35H40N6O2 — CID 68788676
N-[[(3S,5R)-1-benzhydryl-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]-2-naphthalen-2-ylacetamide (PubChem CID 68788676) has the molecular formula C35H40N6O2 and a molecular weight of 576.75 g/mol. Its IUPAC name is N-[[(3S,5R)-1-benzhydryl-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[[(3S,5R)-1-benzhydryl-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 68788676 |
| Molecular Formula | C35H40N6O2 |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | N-[[(3S,5R)-1-benzhydryl-3-[3-(diaminomethylideneamino)propyl]-2-oxo-1,4-diazepan-5-yl]methyl]-2-naphthalen-2-ylacetamide |
| SMILES | NC(N)=NCCC[C@@H]1N[C@@H](CNC(=O)Cc2ccc3ccccc3c2)CCN(C(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C35H40N6O2/c36-35(37)38-20-9-16-31-34(43)41(33(27-11-3-1-4-12-27)28-13-5-2-6-14-28)21-19-30(40-31)24-39-32(42)23-25-17-18-26-10-7-8-15-29(26)22-25/h1-8,10-15,17-18,22,30-31,33,40H,9,16,19-21,23-24H2,(H,39,42)(H4,36,37,38)/t30-,31+/m1/s1 |
| InChIKey | WOWCOUNGGXTIJG-JSOSNVBQSA-N |
| XLogP | 3.90 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|