C35H38N6O2 — CID 91265272
2-[3-[7-benzhydryl-2-(naphthalen-2-ylmethyl)-3,6-dioxo-5,8,9,9a-tetrahydro-1H-imidazo[1,5-d][1,4]diazepin-5-yl]propyl]guanidine (PubChem CID 91265272) has the molecular formula C35H38N6O2 and a molecular weight of 574.73 g/mol. Its IUPAC name is 2-[3-[7-benzhydryl-2-(naphthalen-2-ylmethyl)-3,6-dioxo-5,8,9,9a-tetrahydro-1H-imidazo[1,5-d][1,4]diazepin-5-yl]propyl]guanidine.
| Compound Name | 2-[3-[7-benzhydryl-2-(naphthalen-2-ylmethyl)-3,6-dioxo-5,8,9,9a-tetrahydro-1H-imidazo[1,5-d][1,4]diazepin-5-yl]propyl]guanidine |
|---|---|
| PubChem CID | 91265272 |
| Molecular Formula | C35H38N6O2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 2-[3-[7-benzhydryl-2-(naphthalen-2-ylmethyl)-3,6-dioxo-5,8,9,9a-tetrahydro-1H-imidazo[1,5-d][1,4]diazepin-5-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCC1C(=O)N(C(c2ccccc2)c2ccccc2)CCC2CN(Cc3ccc4ccccc4c3)C(=O)N21 |
| InChI | InChI=1S/C35H38N6O2/c36-34(37)38-20-9-16-31-33(42)40(32(27-11-3-1-4-12-27)28-13-5-2-6-14-28)21-19-30-24-39(35(43)41(30)31)23-25-17-18-26-10-7-8-15-29(26)22-25/h1-8,10-15,17-18,22,30-32H,9,16,19-21,23-24H2,(H4,36,37,38) |
| InChIKey | DCDHFXCXWXKQKO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|