C35H38N4O2 — CID 68754623
(5S,9aS)-5-(4-aminobutyl)-7-benzhydryl-2-(naphthalen-2-ylmethyl)-5,8,9,9a-tetrahydro-1H-imidazo[1,5-d][1,4]diazepine-3,6-dione (PubChem CID 68754623) has the molecular formula C35H38N4O2 and a molecular weight of 546.72 g/mol. Its IUPAC name is (5S,9aS)-5-(4-aminobutyl)-7-benzhydryl-2-(naphthalen-2-ylmethyl)-5,8,9,9a-tetrahydro-1H-imidazo[1,5-d][1,4]diazepine-3,6-dione.
| Compound Name | (5S,9aS)-5-(4-aminobutyl)-7-benzhydryl-2-(naphthalen-2-ylmethyl)-5,8,9,9a-tetrahydro-1H-imidazo[1,5-d][1,4]diazepine-3,6-dione |
|---|---|
| PubChem CID | 68754623 |
| Molecular Formula | C35H38N4O2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | (5S,9aS)-5-(4-aminobutyl)-7-benzhydryl-2-(naphthalen-2-ylmethyl)-5,8,9,9a-tetrahydro-1H-imidazo[1,5-d][1,4]diazepine-3,6-dione |
| SMILES | NCCCC[C@H]1C(=O)N(C(c2ccccc2)c2ccccc2)CC[C@H]2CN(Cc3ccc4ccccc4c3)C(=O)N21 |
| InChI | InChI=1S/C35H38N4O2/c36-21-10-9-17-32-34(40)38(33(28-12-3-1-4-13-28)29-14-5-2-6-15-29)22-20-31-25-37(35(41)39(31)32)24-26-18-19-27-11-7-8-16-30(27)23-26/h1-8,11-16,18-19,23,31-33H,9-10,17,20-22,24-25,36H2/t31-,32-/m0/s1 |
| InChIKey | RXTMKIITKRZLNX-ACHIHNKUSA-N |
| XLogP | 5.97 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|