C26H34N2O — CID 45220754
5-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-(naphthalen-2-ylmethyl)azepan-2-one (PubChem CID 45220754) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is 5-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-(naphthalen-2-ylmethyl)azepan-2-one.
| Compound Name | 5-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-(naphthalen-2-ylmethyl)azepan-2-one |
|---|---|
| PubChem CID | 45220754 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 5-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-(naphthalen-2-ylmethyl)azepan-2-one |
| SMILES | O=C1CCC(N2CC[C@@H]3CCCC[C@H]3C2)CCN1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H34N2O/c29-26-12-11-25(27-15-13-22-6-2-4-8-24(22)19-27)14-16-28(26)18-20-9-10-21-5-1-3-7-23(21)17-20/h1,3,5,7,9-10,17,22,24-25H,2,4,6,8,11-16,18-19H2/t22-,24-,25?/m0/s1 |
| InChIKey | DOFQGSKQSATEIK-VZXIVJASSA-N |
| XLogP | 5.23 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |