C32H32ClN3O2 — CID 10075550
(3S,6S)-6-(4-aminobutyl)-3-[(6-chloronaphthalen-2-yl)methyl]-1-[(4-phenylphenyl)methyl]piperazine-2,5-dione (PubChem CID 10075550) has the molecular formula C32H32ClN3O2 and a molecular weight of 526.08 g/mol. Its IUPAC name is (3S,6S)-6-(4-aminobutyl)-3-[(6-chloronaphthalen-2-yl)methyl]-1-[(4-phenylphenyl)methyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-6-(4-aminobutyl)-3-[(6-chloronaphthalen-2-yl)methyl]-1-[(4-phenylphenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10075550 |
| Molecular Formula | C32H32ClN3O2 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (3S,6S)-6-(4-aminobutyl)-3-[(6-chloronaphthalen-2-yl)methyl]-1-[(4-phenylphenyl)methyl]piperazine-2,5-dione |
| SMILES | NCCCC[C@H]1C(=O)N[C@@H](Cc2ccc3cc(Cl)ccc3c2)C(=O)N1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H32ClN3O2/c33-28-16-15-26-18-23(11-14-27(26)20-28)19-29-32(38)36(30(31(37)35-29)8-4-5-17-34)21-22-9-12-25(13-10-22)24-6-2-1-3-7-24/h1-3,6-7,9-16,18,20,29-30H,4-5,8,17,19,21,34H2,(H,35,37)/t29-,30-/m0/s1 |
| InChIKey | PIHVTFUHDANQKB-KYJUHHDHSA-N |
| XLogP | 5.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|