C34H35N3O2 — CID 10346508
(3S,6S)-6-(4-aminobutyl)-1,3-bis[(4-phenylphenyl)methyl]piperazine-2,5-dione (PubChem CID 10346508) has the molecular formula C34H35N3O2 and a molecular weight of 517.67 g/mol. Its IUPAC name is (3S,6S)-6-(4-aminobutyl)-1,3-bis[(4-phenylphenyl)methyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-6-(4-aminobutyl)-1,3-bis[(4-phenylphenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10346508 |
| Molecular Formula | C34H35N3O2 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | (3S,6S)-6-(4-aminobutyl)-1,3-bis[(4-phenylphenyl)methyl]piperazine-2,5-dione |
| SMILES | NCCCC[C@H]1C(=O)N[C@@H](Cc2ccc(-c3ccccc3)cc2)C(=O)N1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H35N3O2/c35-22-8-7-13-32-33(38)36-31(23-25-14-18-29(19-15-25)27-9-3-1-4-10-27)34(39)37(32)24-26-16-20-30(21-17-26)28-11-5-2-6-12-28/h1-6,9-12,14-21,31-32H,7-8,13,22-24,35H2,(H,36,38)/t31-,32-/m0/s1 |
| InChIKey | ACZBDZQHAWUJDZ-ACHIHNKUSA-N |
| XLogP | 5.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|