C34H49N3O4 — CID 142899863
(3S,6S)-6-(4-aminobutyl)-1-[[4-[(1E)-buta-1,3-dienoxy]phenyl]methyl]-3-[(4-propoxyphenyl)methyl]piperazine-2,5-dione;ethane;prop-1-ene (PubChem CID 142899863) has the molecular formula C34H49N3O4 and a molecular weight of 563.78 g/mol. Its IUPAC name is (3S,6S)-6-(4-aminobutyl)-1-[[4-[(1E)-buta-1,3-dienoxy]phenyl]methyl]-3-[(4-propoxyphenyl)methyl]piperazine-2,5-dione;ethane;prop-1-ene.
| Compound Name | (3S,6S)-6-(4-aminobutyl)-1-[[4-[(1E)-buta-1,3-dienoxy]phenyl]methyl]-3-[(4-propoxyphenyl)methyl]piperazine-2,5-dione;ethane;prop-1-ene |
|---|---|
| PubChem CID | 142899863 |
| Molecular Formula | C34H49N3O4 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.37 |
| IUPAC Name | (3S,6S)-6-(4-aminobutyl)-1-[[4-[(1E)-buta-1,3-dienoxy]phenyl]methyl]-3-[(4-propoxyphenyl)methyl]piperazine-2,5-dione;ethane;prop-1-ene |
| SMILES | C=C/C=C/Oc1ccc(CN2C(=O)[C@H](Cc3ccc(OCCC)cc3)NC(=O)[C@@H]2CCCCN)cc1.C=CC.CC |
| InChI | InChI=1S/C29H37N3O4.C3H6.C2H6/c1-3-5-19-36-25-15-11-23(12-16-25)21-32-27(8-6-7-17-30)28(33)31-26(29(32)34)20-22-9-13-24(14-10-22)35-18-4-2;1-3-2;1-2/h3,5,9-16,19,26-27H,1,4,6-8,17-18,20-21,30H2,2H3,(H,31,33);3H,1H2,2H3;1-2H3/b19-5+;;/t26-,27-;;/m0../s1 |
| InChIKey | ZZHMYQKJHMAABQ-LWGIXHCRSA-N |
| XLogP | 6.34 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|