C37H46N6O2 — CID 163939398
N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-[2-(6-methylcyclohexa-1,3-dien-1-yl)-2-phenylpropyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide (PubChem CID 163939398) has the molecular formula C37H46N6O2 and a molecular weight of 606.82 g/mol. Its IUPAC name is N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-[2-(6-methylcyclohexa-1,3-dien-1-yl)-2-phenylpropyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide.
| Compound Name | N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-[2-(6-methylcyclohexa-1,3-dien-1-yl)-2-phenylpropyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 163939398 |
| Molecular Formula | C37H46N6O2 |
| Molecular Weight | 606.82 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | N-[[(3S,5S)-3-[3-(diaminomethylideneamino)propyl]-1-[2-(6-methylcyclohexa-1,3-dien-1-yl)-2-phenylpropyl]-2-oxo-1,4-diazepan-5-yl]methyl]naphthalene-2-carboxamide |
| SMILES | CC1CC=CC=C1C(C)(CN1CC[C@@H](CNC(=O)c2ccc3ccccc3c2)N[C@@H](CCCN=C(N)N)C1=O)c1ccccc1 |
| InChI | InChI=1S/C37H46N6O2/c1-26-11-6-9-16-32(26)37(2,30-14-4-3-5-15-30)25-43-22-20-31(42-33(35(43)45)17-10-21-40-36(38)39)24-41-34(44)29-19-18-27-12-7-8-13-28(27)23-29/h3-9,12-16,18-19,23,26,31,33,42H,10-11,17,20-22,24-25H2,1-2H3,(H,41,44)(H4,38,39,40)/t26?,31-,33-,37?/m0/s1 |
| InChIKey | RPROQLMZQWJEHR-GGZYONIFSA-N |
| XLogP | 4.66 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|