C35H42N8O2 — CID 74951259
N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-5-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 74951259) has the molecular formula C35H42N8O2 and a molecular weight of 606.78 g/mol. Its IUPAC name is N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-5-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-5-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 74951259 |
| Molecular Formula | C35H42N8O2 |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | N-[[3-[3-(diaminomethylideneamino)propyl]-1-(2,2-diphenylethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-5-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCC2CCN(CC(c3ccccc3)c3ccccc3)C(=O)C(CCCN=C(N)N)N2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C35H42N8O2/c1-25-30(23-40-43(25)29-16-9-4-10-17-29)33(44)39-22-28-19-21-42(34(45)32(41-28)18-11-20-38-35(36)37)24-31(26-12-5-2-6-13-26)27-14-7-3-8-15-27/h2-10,12-17,23,28,31-32,41H,11,18-22,24H2,1H3,(H,39,44)(H4,36,37,38) |
| InChIKey | ZOFQWNXCEGKDES-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 143.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|