C34H43FN6O2 — CID 143853229
(E)-N-[[3-[3-(diaminomethylideneamino)propyl]-2-oxo-1-[(3E)-2-phenyl-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]-1,4-diazepan-5-yl]methyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 143853229) has the molecular formula C34H43FN6O2 and a molecular weight of 586.76 g/mol. Its IUPAC name is (E)-N-[[3-[3-(diaminomethylideneamino)propyl]-2-oxo-1-[(3E)-2-phenyl-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]-1,4-diazepan-5-yl]methyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-[3-(diaminomethylideneamino)propyl]-2-oxo-1-[(3E)-2-phenyl-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]-1,4-diazepan-5-yl]methyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 143853229 |
| Molecular Formula | C34H43FN6O2 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | (E)-N-[[3-[3-(diaminomethylideneamino)propyl]-2-oxo-1-[(3E)-2-phenyl-3-[(Z)-prop-1-enyl]hexa-3,5-dienyl]-1,4-diazepan-5-yl]methyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | C=C/C=C(\C=C/C)C(CN1CCC(CNC(=O)/C=C/c2ccc(F)cc2)NC(CCCN=C(N)N)C1=O)c1ccccc1 |
| InChI | InChI=1S/C34H43FN6O2/c1-3-9-26(10-4-2)30(27-11-6-5-7-12-27)24-41-22-20-29(40-31(33(41)43)13-8-21-38-34(36)37)23-39-32(42)19-16-25-14-17-28(35)18-15-25/h3-7,9-12,14-19,29-31,40H,1,8,13,20-24H2,2H3,(H,39,42)(H4,36,37,38)/b10-4-,19-16+,26-9+ |
| InChIKey | ASKQGBIMWHKEOW-CYNTUZEBSA-N |
| XLogP | 4.04 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|