C27H41ClN4O2 — CID 67374535
3-(4-chlorophenyl)-N-[[(3S,5S)-1-(2-ethylbutyl)-2-oxo-3-(piperidin-1-ylmethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide (PubChem CID 67374535) has the molecular formula C27H41ClN4O2 and a molecular weight of 489.10 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[[(3S,5S)-1-(2-ethylbutyl)-2-oxo-3-(piperidin-1-ylmethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-[[(3S,5S)-1-(2-ethylbutyl)-2-oxo-3-(piperidin-1-ylmethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 67374535 |
| Molecular Formula | C27H41ClN4O2 |
| Molecular Weight | 489.10 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[[(3S,5S)-1-(2-ethylbutyl)-2-oxo-3-(piperidin-1-ylmethyl)-1,4-diazepan-5-yl]methyl]prop-2-enamide |
| SMILES | CCC(CC)CN1CC[C@@H](CNC(=O)C=Cc2ccc(Cl)cc2)N[C@@H](CN2CCCCC2)C1=O |
| InChI | InChI=1S/C27H41ClN4O2/c1-3-21(4-2)19-32-17-14-24(30-25(27(32)34)20-31-15-6-5-7-16-31)18-29-26(33)13-10-22-8-11-23(28)12-9-22/h8-13,21,24-25,30H,3-7,14-20H2,1-2H3,(H,29,33)/t24-,25-/m0/s1 |
| InChIKey | IFIMILOLJZBROZ-DQEYMECFSA-N |
| XLogP | 3.95 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.10 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|