C30H31N7O8S — CID 70094561
benzyl (2R)-2-[[2-[(4R)-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-(phenylcarbamoylsulfamoyl)propanoate (PubChem CID 70094561) has the molecular formula C30H31N7O8S and a molecular weight of 649.69 g/mol. Its IUPAC name is benzyl (2R)-2-[[2-[(4R)-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-(phenylcarbamoylsulfamoyl)propanoate.
| Compound Name | benzyl (2R)-2-[[2-[(4R)-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-(phenylcarbamoylsulfamoyl)propanoate |
|---|---|
| PubChem CID | 70094561 |
| Molecular Formula | C30H31N7O8S |
| Molecular Weight | 649.69 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | benzyl (2R)-2-[[2-[(4R)-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-(phenylcarbamoylsulfamoyl)propanoate |
| SMILES | C[C@]1(c2ccc(C=NN)cc2)NC(=O)N(CC(=O)N[C@@H](CS(=O)(=O)NC(=O)Nc2ccccc2)C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C30H31N7O8S/c1-30(22-14-12-20(13-15-22)16-32-31)27(40)37(29(42)35-30)17-25(38)34-24(26(39)45-18-21-8-4-2-5-9-21)19-46(43,44)36-28(41)33-23-10-6-3-7-11-23/h2-16,24H,17-19,31H2,1H3,(H,34,38)(H,35,42)(H2,33,36,41)/t24-,30+/m0/s1 |
| InChIKey | XRWYUGNKCGLFTM-QABMSTFYSA-N |
| XLogP | 1.13 |
| TPSA | 218.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.69 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|