C17H21N5O5 — CID 21257394
3-[[2-[4-[4-[(E)-hydrazinylidenemethyl]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanoic acid (PubChem CID 21257394) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is 3-[[2-[4-[4-[(E)-hydrazinylidenemethyl]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanoic acid.
| Compound Name | 3-[[2-[4-[4-[(E)-hydrazinylidenemethyl]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 21257394 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-[[2-[4-[4-[(E)-hydrazinylidenemethyl]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CN1C(=O)NC(C)(c2ccc(/C=N/N)cc2)C1=O |
| InChI | InChI=1S/C17H21N5O5/c1-10(7-14(24)25)20-13(23)9-22-15(26)17(2,21-16(22)27)12-5-3-11(4-6-12)8-19-18/h3-6,8,10H,7,9,18H2,1-2H3,(H,20,23)(H,21,27)(H,24,25)/b19-8+ |
| InChIKey | GQLYEBYDECSNSS-UFWORHAWSA-N |
| XLogP | -0.27 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|